| Commit message (Collapse) | Author | Age | Files | Lines |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Add a 'percore' event qualifier, like cpu/event=0,umask=0x3,percore=1/,
that sums up the event counts for both hardware threads in a core.
We can already do this with --per-core, but it's often useful to do
this together with other metrics that are collected per hardware thread.
So we need to support this per-core counting on a event level.
This can be implemented in only the user tool, no kernel support needed.
v4:
---
1. Add Arnaldo's patch which updates the documentation for
this new qualifier.
2. Rebase to latest perf/core branch
v3:
---
Simplify the code according to Jiri's comments.
Before:
"return term->val.percore ? true : false;"
Now:
"return term->val.percore;"
v2:
---
Change the qualifier name from 'coresum' to 'percore' according to
comments from Jiri and Andi.
Signed-off-by: Jin Yao <yao.jin@linux.intel.com>
Tested-by: Ravi Bangoria <ravi.bangoria@linux.ibm.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com>
Cc: Andi Kleen <ak@linux.intel.com>
Cc: Jin Yao <yao.jin@intel.com>
Cc: Kan Liang <kan.liang@linux.intel.com>
Cc: Peter Zijlstra <peterz@infradead.org>
Link: http://lkml.kernel.org/r/1555077590-27664-2-git-send-email-yao.jin@linux.intel.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
The perf metric expression use 'duration_time' internally to normalize
events. Normal 'perf stat' without -x also prints the duration time.
But when using -x, the interval is not output anywhere, which is
inconvenient for any post processing which often wants to normalize
values to time.
So implement 'duration_time' as a proper perf event that can be
specified explicitely with -e.
The previous implementation of 'duration_time' only worked for metric
processing. This adds the concept of a tool event that is handled by the
tool. On the kernel level it is still mapped to the dummy software
event, but the values are not read anymore, but instead computed by the
tool.
Add proper plumbing to handle this in the event parser, and display it
in 'perf stat'. We don't want 'duration_time' to be added up, so it's
only printed for the first CPU.
% perf stat -e duration_time,cycles true
Performance counter stats for 'true':
555,476 ns duration_time
771,958 cycles
0.000555476 seconds time elapsed
0.000644000 seconds user
0.000000000 seconds sys
Signed-off-by: Andi Kleen <ak@linux.intel.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Link: http://lkml.kernel.org/r/20190326221823.11518-3-andi@firstfloor.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This simply adds the field to 'struct perf_evsel' and allows setting
it via the event parser, to test it lets trace trace:
First look at where in a function that receives an evsel we can put a probe
to read how evsel->max_events was setup:
# perf probe -x ~/bin/perf -L trace__event_handler
<trace__event_handler@/home/acme/git/perf/tools/perf/builtin-trace.c:0>
0 static int trace__event_handler(struct trace *trace, struct perf_evsel *evsel,
union perf_event *event __maybe_unused,
struct perf_sample *sample)
3 {
4 struct thread *thread = machine__findnew_thread(trace->host, sample->pid, sample->tid);
5 int callchain_ret = 0;
7 if (sample->callchain) {
8 callchain_ret = trace__resolve_callchain(trace, evsel, sample, &callchain_cursor);
9 if (callchain_ret == 0) {
10 if (callchain_cursor.nr < trace->min_stack)
11 goto out;
12 callchain_ret = 1;
}
}
See what variables we can probe at line 7:
# perf probe -x ~/bin/perf -V trace__event_handler:7
Available variables at trace__event_handler:7
@<trace__event_handler+89>
int callchain_ret
struct perf_evsel* evsel
struct perf_sample* sample
struct thread* thread
struct trace* trace
union perf_event* event
Add a probe at that line asking for evsel->max_events to be collected and named
as "max_events":
# perf probe -x ~/bin/perf trace__event_handler:7 'max_events=evsel->max_events'
Added new event:
probe_perf:trace__event_handler (on trace__event_handler:7 in /home/acme/bin/perf with max_events=evsel->max_events)
You can now use it in all perf tools, such as:
perf record -e probe_perf:trace__event_handler -aR sleep 1
Now use 'perf trace', here aliased to just 'trace' and trace trace, i.e.
the first 'trace' is tracing just that 'probe_perf:trace__event_handler' event,
while the traced trace is tracing all scheduler tracepoints, will stop at two
events (--max-events 2) and will just set evsel->max_events for all the sched
tracepoints to 9, we will see the output of both traces intermixed:
# trace -e *perf:*event_handler trace --max-events 2 -e sched:*/nr=9/
0.000 :0/0 sched:sched_waking:comm=rcu_sched pid=10 prio=120 target_cpu=000
0.009 :0/0 sched:sched_wakeup:comm=rcu_sched pid=10 prio=120 target_cpu=000
0.000 trace/23949 probe_perf:trace__event_handler:(48c34a) max_events=0x9
0.046 trace/23949 probe_perf:trace__event_handler:(48c34a) max_events=0x9
#
Now, if the traced trace sends its output to /dev/null, we'll see just
what the first level trace outputs: that evsel->max_events is indeed
being set to 9:
# trace -e *perf:*event_handler trace -o /dev/null --max-events 2 -e sched:*/nr=9/
0.000 trace/23961 probe_perf:trace__event_handler:(48c34a) max_events=0x9
0.030 trace/23961 probe_perf:trace__event_handler:(48c34a) max_events=0x9
#
Now that we can set evsel->max_events, we can go to the next step, honour that
per-event property in 'perf trace'.
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Milian Wolff <milian.wolff@kdab.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: https://lkml.kernel.org/n/tip-og00yasj276joem6e14l1eas@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Enable complex event names containing [.:=,] symbols to be encoded into Perf
trace using name= modifier e.g. like this:
perf record -e cpu/name=\'OFFCORE_RESPONSE:request=DEMAND_RFO:response=L3_HIT.SNOOP_HITM\',\
period=0x3567e0,event=0x3c,cmask=0x1/Duk ./futex
Below is how it looks like in the report output. Please note explicit escaped
quoting at cmdline string in the header so that thestring can be directly reused
for another collection in shell:
perf report --header
# ========
...
# cmdline : /root/abudanko/kernel/tip/tools/perf/perf record -v -e cpu/name=\'OFFCORE_RESPONSE:request=DEMAND_RFO:response=L3_HIT.SNOOP_HITM\',period=0x3567e0,event=0x3c,cmask=0x1/Duk ./futex
# event : name = OFFCORE_RESPONSE:request=DEMAND_RFO:response=L3_HIT.SNOOP_HITM, , type = 4, size = 112, config = 0x100003c, { sample_period, sample_freq } = 3500000, sample_type = IP|TID|TIME, disabled = 1, inh
...
# ========
#
#
# Total Lost Samples: 0
#
# Samples: 24K of event 'OFFCORE_RESPONSE:request=DEMAND_RFO:response=L3_HIT.SNOOP_HITM'
# Event count (approx.): 86492000000
#
# Overhead Command Shared Object Symbol
# ........ ....... ................ ..............................................
#
14.75% futex [kernel.vmlinux] [k] __entry_trampoline_start
...
perf stat -e cpu/name=\'CPU_CLK_UNHALTED.THREAD:cmask=0x1\',period=0x3567e0,event=0x3c,cmask=0x1/Duk ./futex
10000000 process context switches in 16678890291ns (1667.9ns/ctxsw)
Performance counter stats for './futex':
88,095,770,571 CPU_CLK_UNHALTED.THREAD:cmask=0x1
16.679542407 seconds time elapsed
Signed-off-by: Alexey Budankov <alexey.budankov@linux.intel.com>
Acked-by: Andi Kleen <ak@linux.intel.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Link: http://lkml.kernel.org/r/c194b060-761d-0d50-3b21-bb4ed680002d@linux.intel.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Starting on v4.12 event parsing code for dynamic pmu events already
supports prefix-based matching of multiple pmus when creating dynamic
events. E.g., in a system with the following dynamic pmus:
mypmu_0
mypmu_1
mypmu_2
mypmu_4
passing mypmu/<config>/ as an event spec will result in the creation of
the event in all of the pmus. This change expands this matching through
the use of fnmatch so glob-like expressions can be used to create events
in multiple pmus. E.g., in the system described above if a user only
wants to create the event in mypmu_0 and mypmu_1, mypmu_[01]/<config>/
can be passed.
Signed-off-by: Agustin Vega-Frias <agustinv@codeaurora.org>
Acked-by: Andi Kleen <ak@linux.intel.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com>
Cc: linux-arm-kernel@lists.infradead.org
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Timur Tabi <timur@codeaurora.org>
Change-Id: Icb25653fc5d5239c20f3bffdfdf4ab4c9c9bb20b
Link: http://lkml.kernel.org/r/1520454947-16977-1-git-send-email-agustinv@codeaurora.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|\
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip
Pull perf updates from Ingo Molnar:
"The main changes in this cycle were:
Kernel:
- kprobes updates: use better W^X patterns for code modifications,
improve optprobes, remove jprobes. (Masami Hiramatsu, Kees Cook)
- core fixes: event timekeeping (enabled/running times statistics)
fixes, perf_event_read() locking fixes and cleanups, etc. (Peter
Zijlstra)
- Extend x86 Intel free-running PEBS support and support x86
user-register sampling in perf record and perf script. (Andi Kleen)
Tooling:
- Completely rework the way inline frames are handled. Instead of
querying for the inline nodes on-demand in the individual tools, we
now create proper callchain nodes for inlined frames. (Milian
Wolff)
- 'perf trace' updates (Arnaldo Carvalho de Melo)
- Implement a way to print formatted output to per-event files in
'perf script' to facilitate generate flamegraphs, elliminating the
need to write scripts to do that separation (yuzhoujian, Arnaldo
Carvalho de Melo)
- Update vendor events JSON metrics for Intel's Broadwell, Broadwell
Server, Haswell, Haswell Server, IvyBridge, IvyTown, JakeTown,
Sandy Bridge, Skylake, SkyLake Server - and Goldmont Plus V1 (Andi
Kleen, Kan Liang)
- Multithread the synthesizing of PERF_RECORD_ events for
pre-existing threads in 'perf top', speeding up that phase, greatly
improving the user experience in systems such as Intel's Knights
Mill (Kan Liang)
- Introduce the concept of weak groups in 'perf stat': try to set up
a group, but if it's not schedulable fallback to not using a group.
That gives us the best of both worlds: groups if they work, but
still a usable fallback if they don't. E.g: (Andi Kleen)
- perf sched timehist enhancements (David Ahern)
- ... various other enhancements, updates, cleanups and fixes"
* 'perf-core-for-linus' of git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip: (139 commits)
kprobes: Don't spam the build log with deprecation warnings
arm/kprobes: Remove jprobe test case
arm/kprobes: Fix kretprobe test to check correct counter
perf srcline: Show correct function name for srcline of callchains
perf srcline: Fix memory leak in addr2inlines()
perf trace beauty kcmp: Beautify arguments
perf trace beauty: Implement pid_fd beautifier
tools include uapi: Grab a copy of linux/kcmp.h
perf callchain: Fix double mapping al->addr for children without self period
perf stat: Make --per-thread update shadow stats to show metrics
perf stat: Move the shadow stats scale computation in perf_stat__update_shadow_stats
perf tools: Add perf_data_file__write function
perf tools: Add struct perf_data_file
perf tools: Rename struct perf_data_file to perf_data
perf script: Print information about per-event-dump files
perf trace beauty prctl: Generate 'option' string table from kernel headers
tools include uapi: Grab a copy of linux/prctl.h
perf script: Allow creating per-event dump files
perf evsel: Restore evsel->priv as a tool private area
perf script: Use event_format__fprintf()
...
|
| |\
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
Conflicts:
tools/perf/arch/arm/annotate/instructions.c
tools/perf/arch/arm64/annotate/instructions.c
tools/perf/arch/powerpc/annotate/instructions.c
tools/perf/arch/s390/annotate/instructions.c
tools/perf/arch/x86/tests/intel-cqm.c
tools/perf/ui/tui/progress.c
tools/perf/util/zlib.c
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| |\ \
| | | |
| | | |
| | | | |
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Some of the metrics formulas (like GFLOPs) need to know how long the
measurement period is. Support an internal event called duration_time,
which reports time in second. It maps to the dummy event, but is special
cased for statistics to report the walltime duration.
So far it is not printed, but only used internally for metrics.
Signed-off-by: Andi Kleen <ak@linux.intel.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Link: http://lkml.kernel.org/r/20170831194036.30146-10-andi@firstfloor.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Setting up groups can be complicated due to the complicated scheduling
restrictions of different PMUs.
User tools usually don't understand all these restrictions.
Still in many cases it is useful to set up groups and they work most of
the time. However if the group is set up wrong some members will not
report any value because they never get scheduled.
Add a concept of a 'weak group': try to set up a group, but if it's not
schedulable fallback to not using a group. That gives us the best of
both worlds: groups if they work, but still a usable fallback if they
don't.
In theory it would be possible to have more complex fallback strategies
(e.g. try to split the group in half), but the simple fallback of not
using a group seems to work for now.
So far the weak group is only implemented for perf stat, not for record.
Here's an unschedulable group (on IvyBridge with SMT on)
% perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}' -a sleep 1
73,806,067 branches
4,848,144 branch-misses # 6.57% of all branches
14,754,458 l1d.replacement
24,905,558 l2_lines_in.all
<not supported> l2_rqsts.all_code_rd <------- will never report anything
With the weak group:
% perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}:W' -a sleep 1
125,366,055 branches (80.02%)
9,208,402 branch-misses # 7.35% of all branches (80.01%)
24,560,249 l1d.replacement (80.00%)
43,174,971 l2_lines_in.all (80.05%)
31,891,457 l2_rqsts.all_code_rd (79.92%)
The extra event scheduled with some extra multiplexing
v2: Move fallback code to separate function.
Add comment on for_each_group_member
Adjust to new perf_evsel__close interface
v3: Fix debug print out.
Committer testing:
Before:
# perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}' -a sleep 1
Performance counter stats for 'system wide':
<not counted> branches
<not counted> branch-misses
<not counted> l1d.replacement
<not counted> l2_lines_in.all
<not supported> l2_rqsts.all_code_rd
1.002147212 seconds time elapsed
# perf stat -e '{branches,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}' -a sleep 1
Performance counter stats for 'system wide':
83,207,892 branches
11,065,444 l1d.replacement
28,484,024 l2_lines_in.all
12,186,179 l2_rqsts.all_code_rd
1.001739493 seconds time elapsed
After:
# perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}':W -a sleep 1
Performance counter stats for 'system wide':
543,323,909 branches (80.01%)
27,100,512 branch-misses # 4.99% of all branches (80.02%)
50,402,905 l1d.replacement (80.03%)
67,385,892 l2_lines_in.all (80.01%)
21,352,885 l2_rqsts.all_code_rd (79.94%)
1.001086658 seconds time elapsed
#
Signed-off-by: Andi Kleen <ak@linux.intel.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Link: http://lkml.kernel.org/r/20170831194036.30146-2-andi@firstfloor.org
[ Add a "'perf stat' only, for now" comment in the man page, suggested by Jiri ]
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Looks like I've reached the new level of stupidity, adding missing braces.
Committer testing:
Given the following eBPF C filter, that will add a record when it
returns true, i.e. when the tv_nsec variable is > 2000ns, should be
built and installed via sys_bpf(), but fails to do so before this patch:
# cat filter.c
#include <uapi/linux/bpf.h>
#define SEC(NAME) __attribute__((section(NAME), used))
SEC("func=hrtimer_nanosleep rqtp->tv_nsec")
int func(void *ctx, int err, long nsec)
{
return nsec > 1000;
}
char _license[] SEC("license") = "GPL";
int _version SEC("version") = LINUX_VERSION_CODE;
#
# perf trace -e nanosleep,filter.c usleep 1
invalid or unsupported event: 'filter.c'
Run 'perf list' for a list of valid events
Usage: perf trace [<options>] [<command>]
or: perf trace [<options>] -- <command> [<options>]
or: perf trace record [<options>] [<command>]
or: perf trace record [<options>] -- <command> [<options>]
-e, --event <event> event/syscall selector. use 'perf list' to list available events
#
And works again after it is applied, the nothing is inserted when the co
# perf trace -e *sleep,filter.c usleep 1
0.000 ( 0.066 ms): usleep/23994 nanosleep(rqtp: 0x7ffead94a0d0) = 0
# perf trace -e *sleep,filter.c usleep 2
0.000 ( 0.008 ms): usleep/24378 nanosleep(rqtp: 0x7fffa021ba50) ...
0.008 ( ): perf_bpf_probe:func:(ffffffffb410cb30) tv_nsec=2000)
0.000 ( 0.066 ms): usleep/24378 ... [continued]: nanosleep()) = 0
#
The intent of 9445464bb831 is kept:
# perf stat -e 'cpu/uops_executed.core,krava/' true
event syntax error: '..cuted.core,krava/'
\___ unknown term
valid terms: cmask,pc,event,edge,in_tx,any,ldlat,inv,umask,in_tx_cp,offcore_rsp,config,config1,config2,name,period
Run 'perf list' for a list of valid events
Usage: perf stat [<options>] [<command>]
-e, --event <event> event selector. use 'perf list' to list available events
#
# perf stat -e 'cpu/uops_executed.core,period=1/' true
Performance counter stats for 'true':
808,332 cpu/uops_executed.core,period=1/
0.002997237 seconds time elapsed
#
Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org>
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Cc: Andi Kleen <andi@firstfloor.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT")
Link: http://lkml.kernel.org/n/tip-diea0ihbwpxfw6938huv3whj@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| |_|/
|/| |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
Arnaldo reported broken builds in some distros using a newer flex
release, 2.6.4, found in Alpine Linux 3.6 and Edge, with flex not
spotting the REJECT macro:
CC /tmp/build/perf/util/parse-events-flex.o
util/parse-events.l: In function 'parse_events_lex':
/tmp/build/perf/util/parse-events-flex.c:4734:16: error: \
'reject_used_but_not_detected' undeclared (first use in this function)
It's happening because we put the REJECT under another USER_REJECT macro
in following commit:
9445464bb831 perf tools: Unwind properly location after REJECT
Fortunately flex provides option for force it to use REJECT, adding it
to parse-events.l.
Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org>
Reported-by: Markus Trippelsdorf <markus@trippelsdorf.de>
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Reviewed-by: Andi Kleen <andi@firstfloor.org>
Tested-by: Arnaldo Carvalho de Melo <acme@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT")
Link: http://lkml.kernel.org/n/tip-7kdont984mw12ijk7rji6b8p@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| |/
|/|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
We have defined YY_USER_ACTION to keep trace of the column location
during events parsing, but we need to clean it up when we call REJECT.
When REJECT is called, the lexer shrinks the text and re-runs the
matching, so we need to address it in resuming the previous location
value to keep it correct for error display, like:
Before:
$ perf stat -e 'cpu/uops_executed.core,krava/' true
event syntax error: '..38;5;9:mi=01;05;37;41:su=48;5;196;38;5;15:sg=48;5;1\
1;38;5;16:ca=48;5;196;38;5;226:tw=48;5;10;38;5;16:ow=48;5;10;38;5;21:st=48;5;\
21;38;50
�'
\___ unknown term
After:
$ ./perf stat -e 'cpu/uops_executed.core,krava/' true
event syntax error: '..cuted.core,krava/'
\___ unknown term
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Reported-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Tested-by: Andi Kleen <ak@linux.intel.com>
Cc: Changbin Du <changbin.du@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jin Yao <yao.jin@linux.intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-vug2hchlny30jfsfrumbym26@git.kernel.org
Link: http://lkml.kernel.org/r/20171009140944.GD28623@kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|/
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Adding the check wether the eBPF file exists, to consider it
as eBPF input file. This way we can differentiate eBPF events
from events that end up with same suffix as eBPF file.
Before:
$ perf stat -e 'cpu/uops_executed.core/' true
bpf: builtin compilation failed: -95, try external compiler
WARNING: unable to get correct kernel building directory.
Hint: Set correct kbuild directory using 'kbuild-dir' option in [llvm]
section of ~/.perfconfig or set it to "" to suppress kbuild
detection.
event syntax error: 'cpu/uops_executed.core/'
\___ Failed to load cpu/uops_executed.c from source: 'version' section incorrect or lost
After:
$ perf stat -e 'cpu/uops_executed.core/' true
Performance counter stats for 'true':
181,533 cpu/uops_executed.core/:u
0.002795447 seconds time elapsed
If user makes type in the eBPF file, we prioritize the event syntax
and show following warning:
$ perf stat -e 'krava.c//' true
event syntax error: 'krava.c//'
\___ Cannot find PMU `krava.c'. Missing kernel support?
Reported-and-Tested-by: Andi Kleen <ak@linux.intel.com>
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: Changbin Du <changbin.du@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jin Yao <yao.jin@linux.intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/r/20171013083736.15037-9-jolsa@kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
perf stat -e cpu/uops_executed.core,cmask=1/
would be detected as a BPF source event because the .c matches the .c
source BPF pattern.
v2:
Originally I tried to use lex lookahead, but it doesn't seem to work.
This now extends the BPF pattern to match longer events, but then does
an extra check in the C code to reject BPF matches that do not end with
.c/.o/.obj
This uses REJECT, which makes the flex scanner slower, but that
shouldn't be a big problem for the perf events.
Committer testing:
# perf trace -e write -e /home/acme/bpf/tracepoint.c cat /etc/passwd > /dev/null
0.000 ( 0.006 ms): cat/18485 write(fd: 1, buf: 0x7f59eebe1000, count: 3494 ) ...
0.006 ( ): raw_syscalls:sys_enter:NR 1 (1, 7f59eebe1000, da6, 22, 7f59eebe0010, 0))
0.008 ( ): perf_bpf_probe:_write:(ffffffff9626b2c0))
0.000 ( 0.010 ms): cat/18485 ... [continued]: write()) = 3494
#
It continues doing what was expected, i.e. identifying
/home/acme/bpf/tracepoint.c as a BPF event and activates the clang
machinery to build an eBPF object and then uses sys_bpf() to hook it up
to the raw_syscalls:sys_enter tracepoint, etc.
Andi forgot to add Wang to the CC list, fix it.
Signed-off-by: Andi Kleen <ak@linux.intel.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/r/20170811232634.30465-4-andi@firstfloor.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patch helps with Sukadev's vendor event tree where such events can happen.
>From Andi Kleen:
Any event including a .c/.o/.bpf currently triggers BPF compilation or loading
and then an error. This can happen for some Intel vendor events, which cannot
be used.
This patch fixes this problem by forbidding BPF file patch containing '{', '}'
and ',', make sure flex consumes the leading '{', instead of matching it using
a BPF file path.
Tested result:
$ perf stat -e '{unc_p_clockticks,unc_p_power_state_occupancy.cores_c0}' -a -I 1000
invalid or unsupported event: '{unc_p_clockticks,unc_p_power_state_occupancy.cores_c0}'
Run 'perf list' for a list of valid events
(as expected, interperted as event)
$ perf stat -e 'aaa.c' -a -I 1000
ERROR: problems with path aaa.c: No such file or directory
(as expected, interpreted as BPF source)
$ perf stat -e 'aaa.ccc' -a -I 1000
invalid or unsupported event: 'aaa.ccc'
(as expected, interpreted as event)
$ perf stat -e '{aaa.c}' -a -I 1000
ERROR: problems with path aaa.c: No such file or directory
event syntax error: '{aaa.c}'
<SKIP>
(as expected, interpreted as BPF source)
$ perf stat -e '{cycles,aaa.c}' -a -I 1000
ERROR: problems with path aaa.c: No such file or directory
event syntax error: '{cycles,aaa.c}'
(as expected, interpreted as BPF source)
Signed-off-by: Wang Nan <wangnan0@huawei.com>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Reported-by: Andi Kleen <ak@linux.intel.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Sukadev Bhattiprolu <sukadev@linux.vnet.ibm.com>
Cc: Zefan Li <lizefan@huawei.com>
Cc: pi3orama@163.com
Link: http://lkml.kernel.org/r/1475900185-37967-1-git-send-email-wangnan0@huawei.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patch adds PMU driver specific configuration to the parser
infrastructure by preceding any term with the '@' letter. As such doing
something like:
perf record -e some_event/@cfg1,@cfg2=config/ ...
will see 'cfg1' and 'cfg2=config' being added to the list of evsel
config terms. Token 'cfg1' and 'cfg2=config' are not processed in user
space and are meant to be interpreted by the PMU driver.
First the lexer/parser are supplemented with the required definitions to
recognise the driver specific configuration. From there they are simply
added to the list of event terms. The bulk of the work is done in
function "parse_events_add_pmu()" where driver config event terms are
added to a new list of driver config terms, which in turn spliced with
the event's new driver configuration list.
Signed-off-by: Mathieu Poirier <mathieu.poirier@linaro.org>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com>
Cc: Peter Zijlstra <peterz@infradead.org>
Link: http://lkml.kernel.org/r/1473179837-3293-4-git-send-email-mathieu.poirier@linaro.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patch allows following config terms and option:
Globally setting events to overwrite;
# perf record --overwrite ...
Set specific events to be overwrite or no-overwrite.
# perf record --event cycles/overwrite/ ...
# perf record --event cycles/no-overwrite/ ...
Add missing config terms and update the config term array size because
the longest string length has changed.
For overwritable events, it automatically selects attr.write_backward
since perf requires it to be backward for reading.
Test result:
# perf record --overwrite -e syscalls:*enter_nanosleep* usleep 1
[ perf record: Woken up 2 times to write data ]
[ perf record: Captured and wrote 0.011 MB perf.data (1 samples) ]
# perf evlist -v
syscalls:sys_enter_nanosleep: type: 2, size: 112, config: 0x134, { sample_period, sample_freq }: 1, sample_type: IP|TID|TIME|CPU|PERIOD|RAW, disabled: 1, inherit: 1, mmap: 1, comm: 1, enable_on_exec: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1, write_backward: 1
# Tip: use 'perf evlist --trace-fields' to show fields for tracepoint events
Signed-off-by: Wang Nan <wangnan0@huawei.com>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Cc: Masami Hiramatsu <mhiramat@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Nilay Vaish <nilayvaish@gmail.com>
Cc: Zefan Li <lizefan@huawei.com>
Cc: pi3orama@163.com
Link: http://lkml.kernel.org/r/1468485287-33422-14-git-send-email-wangnan0@huawei.com
Signed-off-by: He Kuang <hekuang@huawei.com>
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Add basic plumbing for TopDown in perf stat
TopDown is intended to replace the frontend cycles idle/ backend cycles
idle metrics in standard perf stat output. These metrics are not
reliable in many workloads, due to out of order effects.
This implements a new --topdown mode in perf stat (similar to
--transaction) that measures the pipe line bottlenecks using
standardized formulas. The measurement can be all done with 5 counters
(one fixed counter)
The result are four metrics:
FrontendBound, BackendBound, BadSpeculation, Retiring
that describe the CPU pipeline behavior on a high level.
The full top down methology has many hierarchical metrics. This
implementation only supports level 1 which can be collected without
multiplexing. A full implementation of top down on top of perf is
available in pmu-tools toplev. (http://github.com/andikleen/pmu-tools)
The current version works on Intel Core CPUs starting with Sandy Bridge,
and Atom CPUs starting with Silvermont. In principle the generic
metrics should be also implementable on other out of order CPUs.
TopDown level 1 uses a set of abstracted metrics which are generic to
out of order CPU cores (although some CPUs may not implement all of
them):
topdown-total-slots Available slots in the pipeline
topdown-slots-issued Slots issued into the pipeline
topdown-slots-retired Slots successfully retired
topdown-fetch-bubbles Pipeline gaps in the frontend
topdown-recovery-bubbles Pipeline gaps during recovery
from misspeculation
These metrics then allow to compute four useful metrics:
FrontendBound, BackendBound, Retiring, BadSpeculation.
Add a new --topdown options to enable events. When --topdown is
specified set up events for all topdown events supported by the kernel.
Add topdown-* as a special case to the event parser, as is needed for
all events containing -.
The actual code to compute the metrics is in follow-on patches.
v2: Use standard sysctl read function.
v3: Move x86 specific code to arch/
v4: Enable --metric-only implicitly for topdown.
v5: Add --single-thread option to not force per core mode
v6: Fix output order of topdown metrics
v7: Allow combining with -d
v8: Remove --single-thread again
v9: Rename functions, adding arch_ and topdown_.
v10: Expand man page and describe TopDown better
Paste intro into commit description.
Print error when malloc fails.
Signed-off-by: Andi Kleen <ak@linux.intel.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Link: http://lkml.kernel.org/r/1464119559-17203-1-git-send-email-andi@firstfloor.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
The tooling counterpart, now it is possible to do:
# perf record -e sched:sched_switch/max-stack=10/ -e cycles/call-graph=dwarf,max-stack=4/ -e cpu-cycles/call-graph=dwarf,max-stack=1024/ usleep 1
[ perf record: Woken up 1 times to write data ]
[ perf record: Captured and wrote 0.052 MB perf.data (5 samples) ]
# perf evlist -v
sched:sched_switch: type: 2, size: 112, config: 0x110, { sample_period, sample_freq }: 1, sample_type: IP|TID|TIME|CALLCHAIN|CPU|PERIOD|RAW|IDENTIFIER, read_format: ID, disabled: 1, inherit: 1, mmap: 1, comm: 1, enable_on_exec: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1, sample_max_stack: 10
cycles/call-graph=dwarf,max-stack=4/: size: 112, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|CALLCHAIN|PERIOD|REGS_USER|STACK_USER|IDENTIFIER, read_format: ID, disabled: 1, inherit: 1, freq: 1, enable_on_exec: 1, sample_id_all: 1, exclude_guest: 1, exclude_callchain_user: 1, sample_regs_user: 0xff0fff, sample_stack_user: 8192, sample_max_stack: 4
cpu-cycles/call-graph=dwarf,max-stack=1024/: size: 112, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|CALLCHAIN|PERIOD|REGS_USER|STACK_USER|IDENTIFIER, read_format: ID, disabled: 1, inherit: 1, freq: 1, enable_on_exec: 1, sample_id_all: 1, exclude_guest: 1, exclude_callchain_user: 1, sample_regs_user: 0xff0fff, sample_stack_user: 8192, sample_max_stack: 1024
# Tip: use 'perf evlist --trace-fields' to show fields for tracepoint events
Using just /max-stack=N/ means /call-graph=fp,max-stack=N/, that should
be further configurable by means of some .perfconfig knob.
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com>
Cc: Alexei Starovoitov <ast@kernel.org>
Cc: Brendan Gregg <brendan.d.gregg@gmail.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Frederic Weisbecker <fweisbec@gmail.com>
Cc: He Kuang <hekuang@huawei.com>
Cc: Jiri Olsa <jolsa@redhat.com>
Cc: Linus Torvalds <torvalds@linux-foundation.org>
Cc: Masami Hiramatsu <mhiramat@kernel.org>
Cc: Milian Wolff <milian.wolff@kdab.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Stephane Eranian <eranian@google.com>
Cc: Thomas Gleixner <tglx@linutronix.de>
Cc: Vince Weaver <vincent.weaver@maine.edu>
Cc: Wang Nan <wangnan0@huawei.com>
Cc: Zefan Li <lizefan@huawei.com>
Link: http://lkml.kernel.org/n/tip-kolmn1yo40p7jhswxwrc7rrd@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Commit a43eec304259 ("bpf: introduce bpf_perf_event_output() helper")
adds a helper to enable a BPF program to output data to a perf ring
buffer through a new type of perf event, PERF_COUNT_SW_BPF_OUTPUT. This
patch enables perf to create events of that type. Now a perf user can
use the following cmdline to receive output data from BPF programs:
# perf record -a -e bpf-output/no-inherit,name=evt/ \
-e ./test_bpf_output.c/map:channel.event=evt/ ls /
# perf script
perf 1560 [004] 347747.086295: evt: ffffffff811fd201 sys_write ...
perf 1560 [004] 347747.086300: evt: ffffffff811fd201 sys_write ...
perf 1560 [004] 347747.086315: evt: ffffffff811fd201 sys_write ...
...
Test result:
# cat test_bpf_output.c
/************************ BEGIN **************************/
#include <uapi/linux/bpf.h>
struct bpf_map_def {
unsigned int type;
unsigned int key_size;
unsigned int value_size;
unsigned int max_entries;
};
#define SEC(NAME) __attribute__((section(NAME), used))
static u64 (*ktime_get_ns)(void) =
(void *)BPF_FUNC_ktime_get_ns;
static int (*trace_printk)(const char *fmt, int fmt_size, ...) =
(void *)BPF_FUNC_trace_printk;
static int (*get_smp_processor_id)(void) =
(void *)BPF_FUNC_get_smp_processor_id;
static int (*perf_event_output)(void *, struct bpf_map_def *, int, void *, unsigned long) =
(void *)BPF_FUNC_perf_event_output;
struct bpf_map_def SEC("maps") channel = {
.type = BPF_MAP_TYPE_PERF_EVENT_ARRAY,
.key_size = sizeof(int),
.value_size = sizeof(u32),
.max_entries = __NR_CPUS__,
};
SEC("func_write=sys_write")
int func_write(void *ctx)
{
struct {
u64 ktime;
int cpuid;
} __attribute__((packed)) output_data;
char error_data[] = "Error: failed to output: %d\n";
output_data.cpuid = get_smp_processor_id();
output_data.ktime = ktime_get_ns();
int err = perf_event_output(ctx, &channel, get_smp_processor_id(),
&output_data, sizeof(output_data));
if (err)
trace_printk(error_data, sizeof(error_data), err);
return 0;
}
char _license[] SEC("license") = "GPL";
int _version SEC("version") = LINUX_VERSION_CODE;
/************************ END ***************************/
# perf record -a -e bpf-output/no-inherit,name=evt/ \
-e ./test_bpf_output.c/map:channel.event=evt/ ls /
# perf script | grep ls
ls 2242 [003] 347851.557563: evt: ffffffff811fd201 sys_write ...
ls 2242 [003] 347851.557571: evt: ffffffff811fd201 sys_write ...
Signed-off-by: Wang Nan <wangnan0@huawei.com>
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Alexei Starovoitov <ast@kernel.org>
Cc: Brendan Gregg <brendan.d.gregg@gmail.com>
Cc: Cody P Schafer <dev@codyps.com>
Cc: He Kuang <hekuang@huawei.com>
Cc: Jeremie Galarneau <jeremie.galarneau@efficios.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Kirill Smelkov <kirr@nexedi.com>
Cc: Li Zefan <lizefan@huawei.com>
Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Zefan Li <lizefan@huawei.com>
Cc: pi3orama@163.com
Link: http://lkml.kernel.org/r/1456132275-98875-11-git-send-email-wangnan0@huawei.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patch introduces a new syntax to perf event parser:
# perf record -e './test_bpf_map_3.c/map:channel.value[0,1,2,3...5]=101/' usleep 2
By utilizing the basic facilities in bpf-loader.c which allow setting
different slots in a BPF map separately, the newly introduced syntax
allows perf to control specific elements in a BPF map.
Test result:
# cat ./test_bpf_map_3.c
/************************ BEGIN **************************/
#include <uapi/linux/bpf.h>
#define SEC(NAME) __attribute__((section(NAME), used))
struct bpf_map_def {
unsigned int type;
unsigned int key_size;
unsigned int value_size;
unsigned int max_entries;
};
static void *(*map_lookup_elem)(struct bpf_map_def *, void *) =
(void *)BPF_FUNC_map_lookup_elem;
static int (*trace_printk)(const char *fmt, int fmt_size, ...) =
(void *)BPF_FUNC_trace_printk;
struct bpf_map_def SEC("maps") channel = {
.type = BPF_MAP_TYPE_ARRAY,
.key_size = sizeof(int),
.value_size = sizeof(unsigned char),
.max_entries = 100,
};
SEC("func=hrtimer_nanosleep rqtp->tv_nsec")
int func(void *ctx, int err, long nsec)
{
char fmt[] = "%ld\n";
long usec = nsec * 0x10624dd3 >> 38; // nsec / 1000
int key = (int)usec;
unsigned char *pval = map_lookup_elem(&channel, &key);
if (!pval)
return 0;
trace_printk(fmt, sizeof(fmt), (unsigned char)*pval);
return 0;
}
char _license[] SEC("license") = "GPL";
int _version SEC("version") = LINUX_VERSION_CODE;
/************************* END ***************************/
Normal case:
# echo "" > /sys/kernel/debug/tracing/trace
# ./perf record -e './test_bpf_map_3.c/map:channel.value[0,1,2,3...5]=101/' usleep 2
[ perf record: Woken up 1 times to write data ]
[ perf record: Captured and wrote 0.012 MB perf.data ]
# cat /sys/kernel/debug/tracing/trace | grep usleep
usleep-405 [004] d... 2745423.547822: : 101
# ./perf record -e './test_bpf_map_3.c/map:channel.value[0...9,20...29]=102,map:channel.value[10...19]=103/' usleep 3
[ perf record: Woken up 1 times to write data ]
[ perf record: Captured and wrote 0.012 MB perf.data ]
# ./perf record -e './test_bpf_map_3.c/map:channel.value[0...9,20...29]=102,map:channel.value[10...19]=103/' usleep 15
[ perf record: Woken up 1 times to write data ]
[ perf record: Captured and wrote 0.012 MB perf.data ]
# cat /sys/kernel/debug/tracing/trace | grep usleep
usleep-405 [004] d... 2745423.547822: : 101
usleep-655 [006] d... 2745434.122814: : 102
usleep-904 [006] d... 2745439.916264: : 103
# ./perf record -e './test_bpf_map_3.c/map:channel.value[all]=104/' usleep 99
# cat /sys/kernel/debug/tracing/trace | grep usleep
usleep-405 [004] d... 2745423.547822: : 101
usleep-655 [006] d... 2745434.122814: : 102
usleep-904 [006] d... 2745439.916264: : 103
usleep-1537 [003] d... 2745538.053737: : 104
Error case:
# ./perf record -e './test_bpf_map_3.c/map:channel.value[10...1000]=104/' usleep 99
event syntax error: '..annel.value[10...1000]=104/'
\___ Index too large
Hint: Valid config terms:
map:[<arraymap>].value<indices>=[value]
map:[<eventmap>].event<indices>=[event]
where <indices> is something like [0,3...5] or [all]
(add -v to see detail)
Run 'perf list' for a list of valid events
Usage: perf record [<options>] [<command>]
or: perf record [<options>] -- <command> [<options>]
-e, --event <event> event selector. use 'perf list' to list available events
Signed-off-by: Wang Nan <wangnan0@huawei.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Alexei Starovoitov <ast@kernel.org>
Cc: Brendan Gregg <brendan.d.gregg@gmail.com>
Cc: Cody P Schafer <dev@codyps.com>
Cc: He Kuang <hekuang@huawei.com>
Cc: Jeremie Galarneau <jeremie.galarneau@efficios.com>
Cc: Kirill Smelkov <kirr@nexedi.com>
Cc: Li Zefan <lizefan@huawei.com>
Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Zefan Li <lizefan@huawei.com>
Cc: pi3orama@163.com
Link: http://lkml.kernel.org/r/1456132275-98875-9-git-send-email-wangnan0@huawei.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patch adds the final step for BPF map configuration. A new syntax
is appended into parser so user can config BPF objects through '/' '/'
enclosed config terms.
After this patch, following syntax is available:
# perf record -e ./test_bpf_map_1.c/map:channel.value=10/ ...
It would takes effect after appling following commits.
Test result:
# cat ./test_bpf_map_1.c
/************************ BEGIN **************************/
#include <uapi/linux/bpf.h>
#define SEC(NAME) __attribute__((section(NAME), used))
struct bpf_map_def {
unsigned int type;
unsigned int key_size;
unsigned int value_size;
unsigned int max_entries;
};
static void *(*map_lookup_elem)(struct bpf_map_def *, void *) =
(void *)BPF_FUNC_map_lookup_elem;
static int (*trace_printk)(const char *fmt, int fmt_size, ...) =
(void *)BPF_FUNC_trace_printk;
struct bpf_map_def SEC("maps") channel = {
.type = BPF_MAP_TYPE_ARRAY,
.key_size = sizeof(int),
.value_size = sizeof(int),
.max_entries = 1,
};
SEC("func=sys_nanosleep")
int func(void *ctx)
{
int key = 0;
char fmt[] = "%d\n";
int *pval = map_lookup_elem(&channel, &key);
if (!pval)
return 0;
trace_printk(fmt, sizeof(fmt), *pval);
return 0;
}
char _license[] SEC("license") = "GPL";
int _version SEC("version") = LINUX_VERSION_CODE;
/************************* END ***************************/
- Normal case:
# ./perf record -e './test_bpf_map_1.c/map:channel.value=10/' usleep 10
[ perf record: Woken up 1 times to write data ]
[ perf record: Captured and wrote 0.012 MB perf.data ]
- Error case:
# ./perf record -e './test_bpf_map_1.c/map:channel.value/' usleep 10
event syntax error: '..ps:channel:value/'
\___ Config value not set (missing '=')
Hint: Valid config term:
map:[<arraymap>]:value=[value]
(add -v to see detail)
Run 'perf list' for a list of valid events
Usage: perf record [<options>] [<command>]
or: perf record [<options>] -- <command> [<options>]
-e, --event <event> event selector. use 'perf list' to list available events
# ./perf record -e './test_bpf_map_1.c/xmap:channel.value=10/' usleep 10
event syntax error: '..pf_map_1.c/xmap:channel.value=10/'
\___ Invalid object config option
[SNIP]
# ./perf record -e './test_bpf_map_1.c/map:xchannel.value=10/' usleep 10
event syntax error: '..p_1.c/map:xchannel.value=10/'
\___ Target map not exist
[SNIP]
# ./perf record -e './test_bpf_map_1.c/map:channel.xvalue=10/' usleep 10
event syntax error: '..ps:channel.xvalue=10/'
\___ Invalid object map config option
[SNIP]
# ./perf record -e './test_bpf_map_1.c/map:channel.value=x10/' usleep 10
event syntax error: '..nnel.value=x10/'
\___ Incorrect value type for map
[SNIP]
Change BPF_MAP_TYPE_ARRAY to '1' in test_bpf_map_1.c:
# ./perf record -e './test_bpf_map_1.c/map:channel.value=10/' usleep 10
event syntax error: '..ps:channel.value=10/'
\___ Can't use this config term to this type of map
Hint: Valid config term:
map:[<arraymap>].value=[value]
(add -v to see detail)
Signed-off-by: Wang Nan <wangnan0@huawei.com>
[for parser part]
Acked-by: Jiri Olsa <jolsa@kernel.org>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Alexei Starovoitov <ast@kernel.org>
Cc: Brendan Gregg <brendan.d.gregg@gmail.com>
Cc: Cody P Schafer <dev@codyps.com>
Cc: He Kuang <hekuang@huawei.com>
Cc: Jeremie Galarneau <jeremie.galarneau@efficios.com>
Cc: Kirill Smelkov <kirr@nexedi.com>
Cc: Li Zefan <lizefan@huawei.com>
Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Zefan Li <lizefan@huawei.com>
Cc: pi3orama@163.com
Link: http://lkml.kernel.org/r/1456132275-98875-5-git-send-email-wangnan0@huawei.com
Signed-off-by: He Kuang <hekuang@huawei.com>
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
config_term_names[] is introduced for future commits which will be able
to retrieve the config name through the config term.
Utilize this array in parse_events_formats_error_string() so the missing
'{,no-}inherit' terms are added.
Signed-off-by: Wang Nan <wangnan0@huawei.com>
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Alexei Starovoitov <ast@kernel.org>
Cc: Brendan Gregg <brendan.d.gregg@gmail.com>
Cc: Cody P Schafer <dev@codyps.com>
Cc: He Kuang <hekuang@huawei.com>
Cc: Jeremie Galarneau <jeremie.galarneau@efficios.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Kirill Smelkov <kirr@nexedi.com>
Cc: Li Zefan <lizefan@huawei.com>
Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Zefan Li <lizefan@huawei.com>
Cc: pi3orama@163.com
Link: http://lkml.kernel.org/r/1455882283-79592-10-git-send-email-wangnan0@huawei.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patch provides infrastructure for passing source files to --event
directly using:
# perf record --event bpf-file.c command
This patch does following works:
1) Allow passing '.c' file to '--event'. parse_events_load_bpf() is
expanded to allow caller tell it whether the passed file is source
file or object.
2) llvm__compile_bpf() is called to compile the '.c' file, the result
is saved into memory. Use bpf_object__open_buffer() to load the
in-memory object.
Introduces a bpf-script-example.c so we can manually test it:
# perf record --clang-opt "-DLINUX_VERSION_CODE=0x40200" --event ./bpf-script-example.c sleep 1
Note that '--clang-opt' must put before '--event'.
Futher patches will merge it into a testcase so can be tested automatically.
Signed-off-by: Wang Nan <wangnan0@huawei.com>
Acked-by: Alexei Starovoitov <ast@plumgrid.com>
Cc: Brendan Gregg <brendan.d.gregg@gmail.com>
Cc: Daniel Borkmann <daniel@iogearbox.net>
Cc: David Ahern <dsahern@gmail.com>
Cc: He Kuang <hekuang@huawei.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Kaixu Xia <xiakaixu@huawei.com>
Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Cc: Zefan Li <lizefan@huawei.com>
Cc: pi3orama@163.com
Link: http://lkml.kernel.org/r/1444826502-49291-10-git-send-email-wangnan0@huawei.com
Signed-off-by: He Kuang <hekuang@huawei.com>
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
By introducing new rules in tools/perf/util/parse-events.[ly], this
patch enables 'perf record --event bpf_file.o' to select events by an
eBPF object file. It calls parse_events_load_bpf() to load that file,
which uses bpf__prepare_load() and finally calls bpf_object__open() for
the object files.
After applying this patch, commands like:
# perf record --event foo.o sleep
become possible.
However, at this point it is unable to link any useful things onto the
evsel list because the creating of probe points and BPF program
attaching have not been implemented. Before real events are possible to
be extracted, to avoid perf report error because of empty evsel list,
this patch link a dummy evsel. The dummy event related code will be
removed when probing and extracting code is ready.
Commiter notes:
Using it:
$ ls -la foo.o
ls: cannot access foo.o: No such file or directory
$ perf record --event foo.o sleep
libbpf: failed to open foo.o: No such file or directory
event syntax error: 'foo.o'
\___ BPF object file 'foo.o' is invalid
(add -v to see detail)
Run 'perf list' for a list of valid events
Usage: perf record [<options>] [<command>]
or: perf record [<options>] -- <command> [<options>]
-e, --event <event> event selector. use 'perf list' to list available events
$
$ file /tmp/build/perf/perf.o
/tmp/build/perf/perf.o: ELF 64-bit LSB relocatable, x86-64, version 1 (SYSV), not stripped
$ perf record --event /tmp/build/perf/perf.o sleep
libbpf: /tmp/build/perf/perf.o is not an eBPF object file
event syntax error: '/tmp/build/perf/perf.o'
\___ BPF object file '/tmp/build/perf/perf.o' is invalid
(add -v to see detail)
Run 'perf list' for a list of valid events
Usage: perf record [<options>] [<command>]
or: perf record [<options>] -- <command> [<options>]
-e, --event <event> event selector. use 'perf list' to list available events
$
$ file /tmp/foo.o
/tmp/foo.o: ELF 64-bit LSB relocatable, no machine, version 1 (SYSV), not stripped
$ perf record --event /tmp/foo.o sleep 1
[ perf record: Woken up 1 times to write data ]
[ perf record: Captured and wrote 0.013 MB perf.data ]
$ perf evlist
/tmp/foo.o
$ perf evlist -v
/tmp/foo.o: type: 1, size: 112, config: 0x9, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|PERIOD, disabled: 1, inherit: 1, mmap: 1, comm: 1, freq: 1, enable_on_exec: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1
$
So, type 1 is PERF_TYPE_SOFTWARE, config 0x9 is PERF_COUNT_SW_DUMMY, ok.
$ perf report --stdio
Error:
The perf.data file has no samples!
# To display the perf.data header info, please use --header/--header-only options.
#
$
Signed-off-by: Wang Nan <wangnan0@huawei.com>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: Alexei Starovoitov <ast@plumgrid.com>
Cc: Brendan Gregg <brendan.d.gregg@gmail.com>
Cc: Daniel Borkmann <daniel@iogearbox.net>
Cc: David Ahern <dsahern@gmail.com>
Cc: He Kuang <hekuang@huawei.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Kaixu Xia <xiakaixu@huawei.com>
Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Cc: Zefan Li <lizefan@huawei.com>
Cc: pi3orama@163.com
Link: http://lkml.kernel.org/r/1444826502-49291-4-git-send-email-wangnan0@huawei.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patch allows perf record setting event's attr.inherit bit by
config terms like:
# perf record -e cycles/no-inherit/ ...
# perf record -e cycles/inherit/ ...
So user can control inherit bit for each event separately.
In following example, a.out fork()s in main then do some complex
CPU intensive computations in both of its children.
Basic result with and without inherit:
# perf record -e cycles -e instructions ./a.out
[ perf record: Woken up 9 times to write data ]
[ perf record: Captured and wrote 2.205 MB perf.data (47920 samples) ]
# perf report --stdio
# ...
# Samples: 23K of event 'cycles'
# Event count (approx.): 23641752891
...
# Samples: 24K of event 'instructions'
# Event count (approx.): 30428312415
# perf record -i -e cycles -e instructions ./a.out
[ perf record: Woken up 5 times to write data ]
[ perf record: Captured and wrote 1.111 MB perf.data (24019 samples) ]
...
# Samples: 12K of event 'cycles'
# Event count (approx.): 11699501775
...
# Samples: 12K of event 'instructions'
# Event count (approx.): 15058023559
Cancel inherit for one event when globally enable:
# perf record -e cycles/no-inherit/ -e instructions ./a.out
[ perf record: Woken up 7 times to write data ]
[ perf record: Captured and wrote 1.660 MB perf.data (36004 samples) ]
...
# Samples: 12K of event 'cycles/no-inherit/'
# Event count (approx.): 11895759282
...
# Samples: 24K of event 'instructions'
# Event count (approx.): 30668000441
Enable inherit for one event when globally disable:
# perf record -i -e cycles/inherit/ -e instructions ./a.out
[ perf record: Woken up 7 times to write data ]
[ perf record: Captured and wrote 1.654 MB perf.data (35868 samples) ]
...
# Samples: 23K of event 'cycles/inherit/'
# Event count (approx.): 23285400229
...
# Samples: 11K of event 'instructions'
# Event count (approx.): 14969050259
Committer note:
One can check if the bit was set, in addition to seeing the result in
the perf.data file size as above by doing one of:
# perf record -e cycles -e instructions -a usleep 1
[ perf record: Woken up 1 times to write data ]
[ perf record: Captured and wrote 0.911 MB perf.data (63 samples) ]
# perf evlist -v
cycles: size: 112, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, inherit: 1, mmap: 1, comm: 1, freq: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1
instructions: size: 112, config: 0x1, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, inherit: 1, freq: 1, sample_id_all: 1, exclude_guest: 1
#
So, the inherit bit was set in both, now, if we disable it globally using
--no-inherit:
# perf record --no-inherit -e cycles -e instructions -a usleep 1
[ perf record: Woken up 1 times to write data ]
[ perf record: Captured and wrote 0.910 MB perf.data (56 samples) ]
# perf evlist -v
cycles: size: 112, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, mmap: 1, comm: 1, freq: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1
instructions: size: 112, config: 0x1, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, freq: 1, sample_id_all: 1, exclude_guest: 1
No inherit bit set, then disabling it and setting just on the cycles event:
# perf record --no-inherit -e cycles/inherit/ -e instructions -a usleep 1
[ perf record: Woken up 1 times to write data ]
[ perf record: Captured and wrote 0.909 MB perf.data (48 samples) ]
# perf evlist -v
cycles/inherit/: size: 112, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, inherit: 1, mmap: 1, comm: 1, freq: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1
instructions: size: 112, config: 0x1, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, freq: 1, sample_id_all: 1, exclude_guest: 1
#
We can see it as well in by using a more verbose level of debug messages in
the tool that sets up the perf_event_attr, 'perf record' in this case:
[root@zoo ~]# perf record -vv --no-inherit -e cycles/inherit/ -e instructions -a usleep 1
------------------------------------------------------------
perf_event_attr:
size 112
{ sample_period, sample_freq } 4000
sample_type IP|TID|TIME|ID|CPU|PERIOD
read_format ID
disabled 1
inherit 1
mmap 1
comm 1
freq 1
task 1
sample_id_all 1
exclude_guest 1
mmap2 1
comm_exec 1
------------------------------------------------------------
sys_perf_event_open: pid -1 cpu 0 group_fd -1 flags 0x8
sys_perf_event_open: pid -1 cpu 1 group_fd -1 flags 0x8
sys_perf_event_open: pid -1 cpu 2 group_fd -1 flags 0x8
sys_perf_event_open: pid -1 cpu 3 group_fd -1 flags 0x8
------------------------------------------------------------
perf_event_attr:
size 112
config 0x1
{ sample_period, sample_freq } 4000
sample_type IP|TID|TIME|ID|CPU|PERIOD
read_format ID
disabled 1
freq 1
sample_id_all 1
exclude_guest 1
------------------------------------------------------------
sys_perf_event_open: pid -1 cpu 0 group_fd -1 flags 0x8
<SNIP>
Signed-off-by: Wang Nan <wangnan0@huawei.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: Alexei Starovoitov <ast@plumgrid.com>
Cc: Brendan Gregg <brendan.d.gregg@gmail.com>
Cc: David S. Miller <davem@davemloft.net>
Cc: Li Zefan <lizefan@huawei.com>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Cc: Zefan Li <lizefan@huawei.com>
Cc: pi3orama@163.com
Link: http://lkml.kernel.org/r/1446029705-199659-2-git-send-email-wangnan0@huawei.com
[ s/u64/bool/ for the perf_evsel_config_term inherit field - jolsa]
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
The 'P' will cause the event to get maximum possible detected precise
level.
Following record:
$ perf record -e cycles:P ...
will detect maximum precise level for 'cycles' event and use it.
Commiter note:
Testing it:
$ perf record -e cycles:P usleep 1
[ perf record: Woken up 1 times to write data ]
[ perf record: Captured and wrote 0.013 MB perf.data (9 samples) ]
$ perf evlist
cycles:P
$ perf evlist -v
cycles:P: size: 112, { sample_period, sample_freq }: 4000, sample_type:
IP|TID|TIME|PERIOD, disabled: 1, inherit: 1, mmap: 1, comm: 1, freq: 1,
enable_on_exec: 1, task: 1, precise_ip: 2, sample_id_all: 1, mmap2: 1,
comm_exec: 1
$
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Don Zickus <dzickus@redhat.com>
Cc: Kan Liang <kan.liang@intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Link: http://lkml.kernel.org/r/1444068369-20978-6-git-send-email-jolsa@kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Show proper error message and show valid terms when wrong config terms
is specified for hw/sw type perf events.
This patch makes the original error format function formats_error_string()
more generic, which only outputs the static config terms for hw/sw perf
events, and prepends pmu formats for pmu events.
Before this patch:
$ perf record -e 'cpu-clock/freqx=200/' -a sleep 1
invalid or unsupported event: 'cpu-clock/freqx=200/'
Run 'perf list' for a list of valid events
usage: perf record [<options>] [<command>]
or: perf record [<options>] -- <command> [<options>]
-e, --event <event> event selector. use 'perf list' to list available events
After this patch:
$ perf record -e 'cpu-clock/freqx=200/' -a sleep 1
event syntax error: 'cpu-clock/freqx=200/'
\___ unknown term
valid terms: config,config1,config2,name,period,freq,branch_type,time,call-graph,stack-size
Run 'perf list' for a list of valid events
usage: perf record [<options>] [<command>]
or: perf record [<options>] -- <command> [<options>]
-e, --event <event> event selector. use 'perf list' to list available events
Signed-off-by: He Kuang <hekuang@huawei.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Kan Liang <kan.liang@intel.com>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Cc: Wang Nan <wangnan0@huawei.com>
Cc: pi3orama@163.com
Link: http://lkml.kernel.org/r/1443412336-120050-2-git-send-email-hekuang@huawei.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patchkit adds the ability to set callgraph mode (fp, dwarf, lbr) per
event. This in term can reduce sampling overhead and the size of the
perf.data.
Here is an example.
perf record -e 'cpu/cpu-cycles,period=1000,call-graph=fp,time=1/,cpu/instructions,call-graph=lbr/' sleep 1
perf evlist -v
cpu/cpu-cycles,period=1000,call-graph=fp,time=1/: type: 4, size: 112,
config: 0x3c, { sample_period, sample_freq }: 1000, sample_type:
IP|TID|TIME|CALLCHAIN|PERIOD|IDENTIFIER, read_format: ID, disabled: 1,
inherit: 1, mmap: 1, comm: 1, enable_on_exec: 1, task: 1, sample_id_all:
1, exclude_guest: 1, mmap2: 1, comm_exec: 1
cpu/instructions,call-graph=lbr/: type: 4, size: 112, config: 0xc0, {
sample_period, sample_freq }: 4000, sample_type:
IP|TID|TIME|CALLCHAIN|PERIOD|BRANCH_STACK|IDENTIFIER, read_format: ID,
disabled: 1, inherit: 1, freq: 1, enable_on_exec: 1, sample_id_all: 1,
exclude_guest: 1
Signed-off-by: Kan Liang <kan.liang@intel.com>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: Andi Kleen <ak@linux.intel.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Link: http://lkml.kernel.org/r/1439289050-40510-1-git-send-email-kan.liang@intel.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Now perf can set per-event value of time and (sampling) period. But I
guess most users like me just want to set frequency rather than period.
So add the 'freq' term in the event parser.
Signed-off-by: Namhyung Kim <namhyung@kernel.org>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Cc: David Ahern <dsahern@gmail.com>
Cc: Kan Liang <kan.liang@intel.com>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Link: http://lkml.kernel.org/r/1439102724-14079-1-git-send-email-namhyung@kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patchkit adds the ability to turn off time stamps per event.
One usaful case for partial time is to work with per-event callgraph to
enable "PEBS threshold > 1" (https://lkml.org/lkml/2015/5/10/196), which
can significantly reduce the sampling overhead.
The event samples with time stamps off will not be ordered.
Signed-off-by: Kan Liang <kan.liang@intel.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Cc: Andi Kleen <ak@linux.intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Link: http://lkml.kernel.org/r/1438677022-34296-2-git-send-email-kan.liang@intel.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
The Intel events use a dot to separate event name and unit mask. Allow
dot in names in the scanner, and remove special handling of dot as EOF.
Also remove the hack in jevents to replace dot with underscore. This way
dotted events can be specified directly by the user.
I'm not fully sure this change to the scanner is correct (what was the
dot special case good for?), but I haven't found anything that breaks
with it so far at least.
Signed-off-by: Andi Kleen <ak@linux.intel.com>
Acked-by: Jiri Olsa <jolsa@redhat.com>
Acked-by: Namhyung Kim <namhyung@kernel.org>
Cc: Madhavan Srinivasan <maddy@linux.vnet.ibm.com>
Cc: Michael Ellerman <mpe@ellerman.id.au>
Cc: linuxppc-dev@lists.ozlabs.org
Link: http://lkml.kernel.org/r/1433921123-25327-8-git-send-email-sukadev@linux.vnet.ibm.com
Signed-off-by: Sukadev Bhattiprolu <sukadev@linux.vnet.ibm.com>
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Allowing event's term processing to report back error, like:
$ perf record -e 'cpu/even=0x1/' ls
event syntax error: 'cpu/even=0x1/'
\___ unknown term
valid terms: pc,any,inv,edge,cmask,event,in_tx,ldlat,umask,in_tx_cp,offcore_rsp,config,config1,config2,name,period,branch_type
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Paul Mackerras <paulus@samba.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Link: http://lkml.kernel.org/r/1429729824-13932-7-git-send-email-jolsa@kernel.org
[ Renamed 'error' variables to 'err', not to clash with util.h error() ]
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Allowing flex parser to report back event parsing error, like:
$ perf record -e cycles,cache-mises ls
event syntax error: '..es,cache-mises'
\___ parser error
...
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Cc: David Ahern <dsahern@gmail.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Paul Mackerras <paulus@samba.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Link: http://lkml.kernel.org/r/1429729824-13932-3-git-send-email-jolsa@kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Adding 'I' event modifier to have complete set of modifiers for
perf_event_attr:exclude_* bits.
Any event specified with 'I' modifier will have the
perf_event_attr:exclude_idle bit set.
$ perf record -e cycles:I -vv ls 2>&1 | grep exclude_idle
exclude_hv 0 exclude_idle 1
Adding automated tests.
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Cc: Andi Kleen <andi@firstfloor.org>
Cc: David Ahern <dsahern@gmail.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Paul Mackerras <paulus@samba.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Cc: William Cohen <wcohen@redhat.com>
Link: http://lkml.kernel.org/r/1428441919-23099-2-git-send-email-jolsa@kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Currently bp_len is given a default value of 4. Allow user to override it:
$ perf stat -e mem:0x1000/8
^
bp_len
If no value is given, it will default to 4 as it did before.
Signed-off-by: Jacob Shin <jacob.w.shin@gmail.com>
Signed-off-by: Suravee Suthikulpanit <suravee.suthikulpanit@amd.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Reviewed-by: Oleg Nesterov <oleg@redhat.com>
Cc: Arnaldo Carvalho de Melo <acme@ghostprotocols.net>
Cc: Ingo Molnar <mingo@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: xiakaixu <xiakaixu@huawei.com>
Signed-off-by: Frederic Weisbecker <fweisbec@gmail.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Add new rules for kernel PMU event.
Currently, the patch only want to handle the PMU event name as "a-b" and
"a".
event_pmu:
PE_KERNEL_PMU_EVENT sep_dc
|
PE_PMU_EVENT_PRE '-' PE_PMU_EVENT_SUF sep_dc
PE_KERNEL_PMU_EVENT token is for
cycles-ct/cycles-t/mem-loads/mem-stores.
The prefix cycles is mixed up with cpu-cycles. loads and stores are
mixed up with cache event So they have to be hardcode in lex.
PE_PMU_EVENT_PRE and PE_PMU_EVENT_SUF tokens are for other PMU events.
The lex looks generic identifier up in the table and return the matched
token. If there is no match, generic PE_NAME token will be return.
Using the rules, kernel PMU event could use new style format without //
so you can use:
perf record -e mem-loads ...
instead of:
perf record -e cpu/mem-loads/
Signed-off-by: Kan Liang <kan.liang@intel.com>
Acked-by: Jiri Olsa <jolsa@redhat.com>
Cc: Andi Kleen <ak@linux.intel.com>
Cc: Jiri Olsa <jolsa@redhat.com>
Link: http://lkml.kernel.org/r/1412694532-23391-4-git-send-email-kan.liang@intel.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Moving start conditions to start of the flex file so it's clear what the
INITIAL condition rules are.
Plus adding default rule for INITIAL condition. This prevents default
space to be printed for events like:
$ ./perf stat -e "cycles " kill 2>/dev/null
$
^^^^^^^^
Signed-off-by: Jiri Olsa <jolsa@redhat.com>
Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com>
Cc: Frederic Weisbecker <fweisbec@gmail.com>
Cc: Ingo Molnar <mingo@elte.hu>
Cc: Paul Mackerras <paulus@samba.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Link: http://lkml.kernel.org/r/1380299398-10839-1-git-send-email-jolsa@redhat.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Add support for the new dummy software event PERF_COUNT_SW_DUMMY.
Signed-off-by: Adrian Hunter <adrian.hunter@intel.com>
Acked-by: Jiri Olsa <jolsa@redhat.com>
Tested-by: Jiri Olsa <jolsa@redhat.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Frederic Weisbecker <fweisbec@gmail.com>
Cc: Ingo Molnar <mingo@redhat.com>
Cc: Jiri Olsa <jolsa@redhat.com>
Cc: Mike Galbraith <efault@gmx.de>
Cc: Namhyung Kim <namhyung@gmail.com>
Cc: Paul Mackerras <paulus@samba.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Cc: Stephane Eranian <eranian@google.com>
Link: http://lkml.kernel.org/r/1377975053-3811-3-git-send-email-adrian.hunter@intel.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This commit adds support for a new modifier "D", which requests that the
event, or group of events, be pinned to the PMU.
The "p" modifier is already taken for precise, and "P" may be used in
future to mean "fully precise".
So we use "D", which stands for pinneD - and looks like a padlock, or if
you're using the ":D" syntax perf smiles at you.
This is an oft-requested feature from our HW folks, who want to be able
to run a large number of events, but also want 100% accurate results for
instructions per cycle.
Comparison of results with and without pinning:
$ perf stat -e '{cycles,instructions}:D' -e cycles,instructions,...
79,590,480,683 cycles # 0.000 GHz
166,123,716,524 instructions # 2.09 insns per cycle
# 0.11 stalled cycles per insn
79,352,134,463 cycles # 0.000 GHz [11.11%]
165,178,301,818 instructions # 2.08 insns per cycle
# 0.11 stalled cycles per insn [11.13%]
As you can see although perf does a very good job of scaling the values
in the non-pinned case, there is some small discrepancy.
The patch is fairly straight forward, the one detail is that we need to
make sure we only request pinning for the group leader when we have a
group.
Signed-off-by: Michael Ellerman <michael@ellerman.id.au>
Acked-by: Namhyung Kim <namhyung@kernel.org>
Acked-by: Jiri Olsa <jolsa@redhat.com>
Tested-by: Jiri Olsa <jolsa@redhat.com>
Cc: Jiri Olsa <jolsa@redhat.com>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Link: http://lkml.kernel.org/r/1375795686-4226-1-git-send-email-michael@ellerman.id.au
[ Use perf_evsel__is_group_leader instead of open coded equivalent, as
suggested by Jiri Olsa ]
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Adding 'S' event/group modifier to specify that the event value/s are
read by PERF_SAMPLE_READ sample type processing, instead of the period
value offered by lower layers.
There's additional behaviour change for 'S' modifier being specified on
event group:
Currently all the events within a group makes samples. If user now
specifies 'S' within group modifier, only the leader will trigger
samples. The rest of events in the group will have sampling disabled.
And same as for single events, values of all events within the group
(including leader) are read by PERF_SAMPLE_READ sample type processing.
Following example will create event group with cycles and cache-misses
events, setting the cycles as group leader and the only event to
actually sample. Both cycles and cache-misses event period values are
read by PERF_SAMPLE_READ sample type processing with PERF_FORMAT_GROUP
read format.
Example:
$ perf record -e '{cycles,cache-misses}:S' ls
...
$ perf report --group --show-total-period --stdio
...
# Samples: 36 of event 'anon group { cycles, cache-misses }'
# Event count (approx.): 12585593
#
# Overhead Period Command Shared Object Symbol
# .............. .............. ....... ................. ..........................
#
19.92% 1.20% 2505936 31 ls [kernel.kallsyms] [k] mark_held_locks
13.74% 0.47% 1729327 12 ls [kernel.kallsyms] [k] sched_clock_local
13.64% 23.72% 1716147 612 ls ld-2.14.90.so [.] check_match.10805
13.12% 23.22% 1650778 599 ls libc-2.14.90.so [.] _nl_intern_locale_data
11.24% 29.19% 1414554 753 ls [kernel.kallsyms] [k] sched_clock_cpu
8.50% 0.35% 1070150 9 ls [kernel.kallsyms] [k] check_chain_key
...
Signed-off-by: Jiri Olsa <jolsa@redhat.com>
Acked-by: Namhyung Kim <namhyung@kernel.org>
Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com>
Cc: Frederic Weisbecker <fweisbec@gmail.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Paul Mackerras <paulus@samba.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Link: http://lkml.kernel.org/n/tip-iyoinu3axi11mymwnh2b7fxj@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Updating event parser to allow any non zero string containing [ukhpGH]
characters for event modifier.
The modifier sanity is checked later in parse-event object logic. The
check validates modifier to contain only one instance of any modifier
(apart from 'p') present.
v2:
- added length check suggested Namhyung Kim
Signed-off-by: Jiri Olsa <jolsa@redhat.com>
Acked-by: Namhyung Kim <namhyung@kernel.org>
Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com>
Cc: Frederic Weisbecker <fweisbec@gmail.com>
Cc: Ingo Molnar <mingo@elte.hu>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Paul Mackerras <paulus@samba.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Link: http://lkml.kernel.org/r/20121113143258.GA2481@krava.brq.redhat.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
- Add missing scanner symbol for arbitrary aliases inside the config
region.
- looks nicer than _, so allow - in the event names. Used for various of
the arch perfmon and Haswell events.
Signed-off-by: Andi Kleen <ak@linux.intel.com>
Cc: Ingo Molnar <mingo@elte.hu>
Cc: Jiri Olsa <jolsa@redhat.com>
Cc: Namhyung Kim <namhyung.kim@lge.com>
Cc: Peter Zijlstra <peterz@infradead.org>
Link: http://lkml.kernel.org/r/1352123463-7346-6-git-send-email-eranian@google.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
perf defines both __used and __unused variables to use for marking
unused variables. The variable __used is defined to
__attribute__((__unused__)), which contradicts the kernel definition to
__attribute__((__used__)) for new gcc versions. On Android, __used is
also defined in system headers and this leads to warnings like: warning:
'__used__' attribute ignored
__unused is not defined in the kernel and is not a standard definition.
If __unused is included everywhere instead of __used, this leads to
conflicts with glibc headers, since glibc has a variables with this name
in its headers.
The best approach is to use __maybe_unused, the definition used in the
kernel for __attribute__((unused)). In this way there is only one
definition in perf sources (instead of 2 definitions that point to the
same thing: __used and __unused) and it works on both Linux and Android.
This patch simply replaces all instances of __used and __unused with
__maybe_unused.
Signed-off-by: Irina Tirdea <irina.tirdea@intel.com>
Acked-by: Pekka Enberg <penberg@kernel.org>
Cc: David Ahern <dsahern@gmail.com>
Cc: Ingo Molnar <mingo@redhat.com>
Cc: Namhyung Kim <namhyung.kim@lge.com>
Cc: Paul Mackerras <paulus@samba.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Cc: Steven Rostedt <rostedt@goodmis.org>
Link: http://lkml.kernel.org/r/1347315303-29906-7-git-send-email-irina.tirdea@intel.com
[ committer note: fixed up conflict with a116e05 in builtin-sched.c ]
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Use command line string provided by the -e option to name events. This
way we get unique events names that also support pmu event syntax
(<pmu_name>/<config>/<modifier>). No need to reconstruct the name
anymore from its attributes. We use the event_desc of the header to
store the name in the perf.data header. Thus it is also available for
perf report.
Implemented by putting the parser in different states to parse events or
configs.
And since event names are now generated from the command line
specification. Update event names in test cases accordingly.
Signed-off-by: Robert Richter <robert.richter@amd.com>
Cc: Ingo Molnar <mingo@kernel.org>
Cc: Jiri Olsa <jolsa@redhat.com>
Cc: Peter Zijlstra <peterz@infradead.org>
Link: http://lkml.kernel.org/r/1345144224-27280-6-git-send-email-robert.richter@amd.com
[ committer note: Folded patch fixing 'perf test' failure reported by Jiri Olsa ]
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Adding scanner/parser bits to parse event groups.
The grammar for group is:
groups: groups ',' group | group
group: group_name '{' events '}' group_mod
group_name: name | empty
group_mod: ':' group_mods | empty
group_mods: event_mod
It's possible to use standard event modifier as a modifier
for group. It'll be used as an update to existing event
modifiers.
It's necessary to use quoting ("'\) when specifying group on
command line, since {} characters are interpreted by most of
the shells.
It is now possible to specify groups in event syntax like:
'{cycles,faults}'
- anonymous group
'group1{cycles,faults}
- group with name 'group1'
'{cycles,faults}:k
- anonymous group with event modifier 'k'
'{cpu-clock,task-clock},{minor-faults,major-faults}'
- two anonymous groups
The grouping functionality itself is coming shortly.
Reviewed-by: Namhyung Kim <namhyung@kernel.org>
Signed-off-by: Jiri Olsa <jolsa@redhat.com>
Acked-by: Peter Zijlstra <peterz@infradead.org>
Cc: Andi Kleen <andi@firstfloor.org>
Cc: Arnaldo Carvalho de Melo <acme@ghostprotocols.net>
Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com>
Cc: Frederic Weisbecker <fweisbec@gmail.com>
Cc: Ingo Molnar <mingo@elte.hu>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Paul Mackerras <paulus@samba.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Cc: Thomas Gleixner <tglx@linutronix.de>
Cc: Ulrich Drepper <drepper@gmail.com>
Link: http://lkml.kernel.org/n/tip-p4j8bnvo879uokum4k4zk5q6@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
perf record fails on 32 bit with:
invalid or unsupported event: 'r40000F7E0'
Fixing this by parsing 64 bit num values.
Signed-off-by: Robert Richter <robert.richter@amd.com>
Cc: Ingo Molnar <mingo@kernel.org>
Link: http://lkml.kernel.org/r/1344361396-7237-4-git-send-email-robert.richter@amd.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Spliting PE_VALUE_SYM token to PE_VALUE_SYM_HW and PE_VALUE_SYM_SW
tokens to separate hardware and software symbols.
This will be useful in upcomming patch where we want to be able to parse
out only hardware events.
Signed-off-by: Jiri Olsa <jolsa@redhat.com>
Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com>
Cc: Frederic Weisbecker <fweisbec@gmail.com>
Cc: Ingo Molnar <mingo@elte.hu>
Cc: Paul Mackerras <paulus@samba.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Cc: Stephane Eranian <eranian@google.com>
Link: http://lkml.kernel.org/r/1341352848-11833-6-git-send-email-jolsa@redhat.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
The flex generator prints out each input character that is ignored by
lex rules.
Since the alias processing, we can have '\n' characters on input. We
need to assign empty rule to it, so it's not printed out.
Signed-off-by: Jiri Olsa <jolsa@redhat.com>
Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com>
Cc: Frederic Weisbecker <fweisbec@gmail.com>
Cc: Ingo Molnar <mingo@elte.hu>
Cc: Paul Mackerras <paulus@samba.org>
Cc: Peter Zijlstra <a.p.zijlstra@chello.nl>
Cc: Stephane Eranian <eranian@google.com>
Link: http://lkml.kernel.org/r/1341352848-11833-2-git-send-email-jolsa@redhat.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|